C18H28O3 — CID 162975926
1,4a,5-trimethyl-1-(3-oxobutyl)-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylic acid (PubChem CID 162975926) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1,4a,5-trimethyl-1-(3-oxobutyl)-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylic acid.
| Compound Name | 1,4a,5-trimethyl-1-(3-oxobutyl)-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 162975926 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1,4a,5-trimethyl-1-(3-oxobutyl)-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylic acid |
| SMILES | CC(=O)CCC1(C)C(C(=O)O)CCC2(C)C(C)=CCCC21 |
| InChI | InChI=1S/C18H28O3/c1-12-6-5-7-15-17(12,3)11-9-14(16(20)21)18(15,4)10-8-13(2)19/h6,14-15H,5,7-11H2,1-4H3,(H,20,21) |
| InChIKey | HTPPATYWLRBHDR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|