C21H30O5 — CID 163072681
1-[2-(2-methoxy-5-oxo-2H-furan-4-yl)ethyl]-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylic acid (PubChem CID 163072681) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is 1-[2-(2-methoxy-5-oxo-2H-furan-4-yl)ethyl]-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylic acid.
| Compound Name | 1-[2-(2-methoxy-5-oxo-2H-furan-4-yl)ethyl]-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 163072681 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 1-[2-(2-methoxy-5-oxo-2H-furan-4-yl)ethyl]-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylic acid |
| SMILES | COC1C=C(CCC2(C)C(C(=O)O)CCC3(C)C(C)=CCCC32)C(=O)O1 |
| InChI | InChI=1S/C21H30O5/c1-13-6-5-7-16-20(13,2)11-9-15(18(22)23)21(16,3)10-8-14-12-17(25-4)26-19(14)24/h6,12,15-17H,5,7-11H2,1-4H3,(H,22,23) |
| InChIKey | RBOVBGSBFUZCEO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|