C31H46O10 — CID 163085539
(4,5-diacetyloxy-3-hydroxyoxan-2-yl) 1-(5-acetyloxy-3-methylpent-3-enyl)-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylate (PubChem CID 163085539) has the molecular formula C31H46O10 and a molecular weight of 578.70 g/mol. Its IUPAC name is (4,5-diacetyloxy-3-hydroxyoxan-2-yl) 1-(5-acetyloxy-3-methylpent-3-enyl)-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylate.
| Compound Name | (4,5-diacetyloxy-3-hydroxyoxan-2-yl) 1-(5-acetyloxy-3-methylpent-3-enyl)-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 163085539 |
| Molecular Formula | C31H46O10 |
| Molecular Weight | 578.70 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | (4,5-diacetyloxy-3-hydroxyoxan-2-yl) 1-(5-acetyloxy-3-methylpent-3-enyl)-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalene-2-carboxylate |
| SMILES | CC(=O)OCC=C(C)CCC1(C)C(C(=O)OC2OCC(OC(C)=O)C(OC(C)=O)C2O)CCC2(C)C(C)=CCCC21 |
| InChI | InChI=1S/C31H46O10/c1-18(13-16-37-20(3)32)11-14-31(7)23(12-15-30(6)19(2)9-8-10-25(30)31)28(36)41-29-26(35)27(40-22(5)34)24(17-38-29)39-21(4)33/h9,13,23-27,29,35H,8,10-12,14-17H2,1-7H3 |
| InChIKey | IXDNKJKDUXFRCW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.70 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|