C26H40O6 — CID 163102320
(3S,3aR,6S,6aS)-6-[(E)-5-[(1S,2R,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-3,6,6a-trihydroxy-3,3a-dihydro-2H-furo[3,2-b]furan-5-one (PubChem CID 163102320) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is (3S,3aR,6S,6aS)-6-[(E)-5-[(1S,2R,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-3,6,6a-trihydroxy-3,3a-dihydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (3S,3aR,6S,6aS)-6-[(E)-5-[(1S,2R,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-3,6,6a-trihydroxy-3,3a-dihydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 163102320 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (3S,3aR,6S,6aS)-6-[(E)-5-[(1S,2R,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-3,6,6a-trihydroxy-3,3a-dihydro-2H-furo[3,2-b]furan-5-one |
| SMILES | CC1=CCC[C@H]2[C@@](C)(CC/C(C)=C/C[C@@]3(O)C(=O)O[C@@H]4[C@@H](O)CO[C@@]43O)[C@H](C)CC[C@@]12C |
| InChI | InChI=1S/C26H40O6/c1-16(10-14-25(29)22(28)32-21-19(27)15-31-26(21,25)30)9-12-23(4)18(3)11-13-24(5)17(2)7-6-8-20(23)24/h7,10,18-21,27,29-30H,6,8-9,11-15H2,1-5H3/b16-10+/t18-,19+,20+,21-,23+,24+,25-,26+/m1/s1 |
| InChIKey | GUGKETBJPXLNIM-DASHNJABSA-N |
| XLogP | 3.64 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|