C27H41N5O — CID 10939343
N-[(E)-5-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-N-methoxy-9-methylpurin-6-amine (PubChem CID 10939343) has the molecular formula C27H41N5O and a molecular weight of 451.66 g/mol. Its IUPAC name is N-[(E)-5-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-N-methoxy-9-methylpurin-6-amine.
| Compound Name | N-[(E)-5-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-N-methoxy-9-methylpurin-6-amine |
|---|---|
| PubChem CID | 10939343 |
| Molecular Formula | C27H41N5O |
| Molecular Weight | 451.66 g/mol |
| Exact Mass | 451.33 |
| IUPAC Name | N-[(E)-5-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-N-methoxy-9-methylpurin-6-amine |
| SMILES | CON(C/C=C(\C)CC[C@@]1(C)[C@H](C)CC[C@@]2(C)C(C)=CCC[C@H]12)c1ncnc2c1ncn2C |
| InChI | InChI=1S/C27H41N5O/c1-19(13-16-32(33-7)25-23-24(28-17-29-25)31(6)18-30-23)11-14-26(4)21(3)12-15-27(5)20(2)9-8-10-22(26)27/h9,13,17-18,21-22H,8,10-12,14-16H2,1-7H3/b19-13+/t21-,22-,26+,27+/m1/s1 |
| InChIKey | YJCKIWSKLCQUJC-DSEFFAGJSA-N |
| XLogP | 6.26 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|