C27H50N5+ — CID 162855646
7-[6-[(1R,2S,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-4-methylhex-3-enyl]-9-methyl-1,2,3,4,5,6,7,8-octahydropurin-7-ium-6-amine (PubChem CID 162855646) has the molecular formula C27H50N5+ and a molecular weight of 444.73 g/mol. Its IUPAC name is 7-[6-[(1R,2S,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-4-methylhex-3-enyl]-9-methyl-1,2,3,4,5,6,7,8-octahydropurin-7-ium-6-amine.
| Compound Name | 7-[6-[(1R,2S,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-4-methylhex-3-enyl]-9-methyl-1,2,3,4,5,6,7,8-octahydropurin-7-ium-6-amine |
|---|---|
| PubChem CID | 162855646 |
| Molecular Formula | C27H50N5+ |
| Molecular Weight | 444.73 g/mol |
| Exact Mass | 444.41 |
| IUPAC Name | 7-[6-[(1R,2S,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-4-methylhex-3-enyl]-9-methyl-1,2,3,4,5,6,7,8-octahydropurin-7-ium-6-amine |
| SMILES | CC(=CCC[NH+]1CN(C)C2NCNC(N)C21)CC[C@]1(C)[C@@H](C)CC[C@@]2(C)C(C)=CCC[C@@H]12 |
| InChI | InChI=1S/C27H49N5/c1-19(9-8-16-32-18-31(6)25-23(32)24(28)29-17-30-25)12-14-26(4)21(3)13-15-27(5)20(2)10-7-11-22(26)27/h9-10,21-25,29-30H,7-8,11-18,28H2,1-6H3/p+1/t21-,22-,23?,24?,25?,26+,27-/m0/s1 |
| InChIKey | ODTKLARLZVCKPM-CGUZFZSDSA-O |
| XLogP | 2.82 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.73 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|