C26H41N5O — CID 163017334
N-[5-[(1R,2S,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-N-[4-amino-6-(methylamino)pyrimidin-5-yl]formamide (PubChem CID 163017334) has the molecular formula C26H41N5O and a molecular weight of 439.65 g/mol. Its IUPAC name is N-[5-[(1R,2S,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-N-[4-amino-6-(methylamino)pyrimidin-5-yl]formamide.
| Compound Name | N-[5-[(1R,2S,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-N-[4-amino-6-(methylamino)pyrimidin-5-yl]formamide |
|---|---|
| PubChem CID | 163017334 |
| Molecular Formula | C26H41N5O |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.33 |
| IUPAC Name | N-[5-[(1R,2S,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpent-2-enyl]-N-[4-amino-6-(methylamino)pyrimidin-5-yl]formamide |
| SMILES | CNc1ncnc(N)c1N(C=O)CC=C(C)CC[C@]1(C)[C@@H](C)CC[C@@]2(C)C(C)=CCC[C@@H]12 |
| InChI | InChI=1S/C26H41N5O/c1-18(12-15-31(17-32)22-23(27)29-16-30-24(22)28-6)10-13-25(4)20(3)11-14-26(5)19(2)8-7-9-21(25)26/h8,12,16-17,20-21H,7,9-11,13-15H2,1-6H3,(H3,27,28,29,30)/t20-,21-,25+,26-/m0/s1 |
| InChIKey | SGKIRYPVJGUSPZ-MSNAGZIKSA-N |
| XLogP | 5.59 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|