C20H32O5 — CID 95789873
(2S,3R,3aR,6S,7S,7aR)-7-[(Z)-4-carboxy-3-methylbut-3-enyl]-3-hydroxy-3,3a,6,7-tetramethyl-1,2,4,5,6,7a-hexahydroindene-2-carboxylic acid (PubChem CID 95789873) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is (2S,3R,3aR,6S,7S,7aR)-7-[(Z)-4-carboxy-3-methylbut-3-enyl]-3-hydroxy-3,3a,6,7-tetramethyl-1,2,4,5,6,7a-hexahydroindene-2-carboxylic acid.
| Compound Name | (2S,3R,3aR,6S,7S,7aR)-7-[(Z)-4-carboxy-3-methylbut-3-enyl]-3-hydroxy-3,3a,6,7-tetramethyl-1,2,4,5,6,7a-hexahydroindene-2-carboxylic acid |
|---|---|
| PubChem CID | 95789873 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (2S,3R,3aR,6S,7S,7aR)-7-[(Z)-4-carboxy-3-methylbut-3-enyl]-3-hydroxy-3,3a,6,7-tetramethyl-1,2,4,5,6,7a-hexahydroindene-2-carboxylic acid |
| SMILES | C/C(=C/C(=O)O)CC[C@]1(C)[C@H]2C[C@H](C(=O)O)[C@@](C)(O)[C@]2(C)CC[C@@H]1C |
| InChI | InChI=1S/C20H32O5/c1-12(10-16(21)22)6-8-18(3)13(2)7-9-19(4)15(18)11-14(17(23)24)20(19,5)25/h10,13-15,25H,6-9,11H2,1-5H3,(H,21,22)(H,23,24)/b12-10-/t13-,14+,15+,18-,19+,20+/m0/s1 |
| InChIKey | AYRBKDVFDHNFQF-OEKWXJIXSA-N |
| XLogP | 3.71 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|