C24H40O4 — CID 10971238
ethyl (E)-5-[(1'S,2'R,4'aS,5'S,8'aS)-1',2',4'a,5'-tetramethylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydro-2H-naphthalene]-1'-yl]-3-methylpent-2-enoate (PubChem CID 10971238) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is ethyl (E)-5-[(1'S,2'R,4'aS,5'S,8'aS)-1',2',4'a,5'-tetramethylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydro-2H-naphthalene]-1'-yl]-3-methylpent-2-enoate.
| Compound Name | ethyl (E)-5-[(1'S,2'R,4'aS,5'S,8'aS)-1',2',4'a,5'-tetramethylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydro-2H-naphthalene]-1'-yl]-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 10971238 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | ethyl (E)-5-[(1'S,2'R,4'aS,5'S,8'aS)-1',2',4'a,5'-tetramethylspiro[1,3-dioxolane-2,7'-3,4,5,6,8,8a-hexahydro-2H-naphthalene]-1'-yl]-3-methylpent-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)CC[C@]1(C)[C@@H]2CC3(C[C@H](C)[C@]2(C)CC[C@H]1C)OCCO3 |
| InChI | InChI=1S/C24H40O4/c1-7-26-21(25)14-17(2)8-10-22(5)18(3)9-11-23(6)19(4)15-24(16-20(22)23)27-12-13-28-24/h14,18-20H,7-13,15-16H2,1-6H3/b17-14+/t18-,19+,20+,22+,23+/m1/s1 |
| InChIKey | RJDUNTYCNSNDNN-KSLRQRKLSA-N |
| XLogP | 5.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|