C23H39ClO5 — CID 102456419
[(2R)-2,3-dihydroxypropyl] (E)-5-[(1R,2S,4aS,5R,8aS)-5-(chloromethyl)-5-hydroxy-1,2,4a-trimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate (PubChem CID 102456419) has the molecular formula C23H39ClO5 and a molecular weight of 431.01 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] (E)-5-[(1R,2S,4aS,5R,8aS)-5-(chloromethyl)-5-hydroxy-1,2,4a-trimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] (E)-5-[(1R,2S,4aS,5R,8aS)-5-(chloromethyl)-5-hydroxy-1,2,4a-trimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 102456419 |
| Molecular Formula | C23H39ClO5 |
| Molecular Weight | 431.01 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] (E)-5-[(1R,2S,4aS,5R,8aS)-5-(chloromethyl)-5-hydroxy-1,2,4a-trimethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enoate |
| SMILES | C/C(=C\C(=O)OC[C@H](O)CO)CC[C@]1(C)[C@@H](C)CC[C@@]2(C)[C@H]1CCC[C@]2(O)CCl |
| InChI | InChI=1S/C23H39ClO5/c1-16(12-20(27)29-14-18(26)13-25)7-10-21(3)17(2)8-11-22(4)19(21)6-5-9-23(22,28)15-24/h12,17-19,25-26,28H,5-11,13-15H2,1-4H3/b16-12+/t17-,18+,19-,21+,22-,23-/m0/s1 |
| InChIKey | OJNFYJWRNLIGEB-OTECBNLZSA-N |
| XLogP | 3.82 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.01 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|