C20H34O — CID 5375222
(E)-5-(4,5-dimethyl-7a-prop-1-en-2-yl-2,3,3a,5,6,7-hexahydro-1H-inden-4-yl)-3-methylpent-2-en-1-ol (PubChem CID 5375222) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (E)-5-(4,5-dimethyl-7a-prop-1-en-2-yl-2,3,3a,5,6,7-hexahydro-1H-inden-4-yl)-3-methylpent-2-en-1-ol.
| Compound Name | (E)-5-(4,5-dimethyl-7a-prop-1-en-2-yl-2,3,3a,5,6,7-hexahydro-1H-inden-4-yl)-3-methylpent-2-en-1-ol |
|---|---|
| PubChem CID | 5375222 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (E)-5-(4,5-dimethyl-7a-prop-1-en-2-yl-2,3,3a,5,6,7-hexahydro-1H-inden-4-yl)-3-methylpent-2-en-1-ol |
| SMILES | C=C(C)C12CCCC1C(C)(CC/C(C)=C/CO)C(C)CC2 |
| InChI | InChI=1S/C20H34O/c1-15(2)20-11-6-7-18(20)19(5,17(4)9-13-20)12-8-16(3)10-14-21/h10,17-18,21H,1,6-9,11-14H2,2-5H3/b16-10+ |
| InChIKey | BGKGISCHOLIBDN-MHWRWJLKSA-N |
| XLogP | 5.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|