C27H42N4O2 — CID 162884168
7-[5-[(1S,2R,4aS,8aR)-4a-hydroxy-1,2,5,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enyl]-2,3-dimethylpurin-6-one (PubChem CID 162884168) has the molecular formula C27H42N4O2 and a molecular weight of 454.66 g/mol. Its IUPAC name is 7-[5-[(1S,2R,4aS,8aR)-4a-hydroxy-1,2,5,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enyl]-2,3-dimethylpurin-6-one.
| Compound Name | 7-[5-[(1S,2R,4aS,8aR)-4a-hydroxy-1,2,5,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enyl]-2,3-dimethylpurin-6-one |
|---|---|
| PubChem CID | 162884168 |
| Molecular Formula | C27H42N4O2 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | 7-[5-[(1S,2R,4aS,8aR)-4a-hydroxy-1,2,5,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-methylpent-2-enyl]-2,3-dimethylpurin-6-one |
| SMILES | CC(=CCn1cnc2c1c(=O)nc(C)n2C)CC[C@@]1(C)[C@H](C)CC[C@]2(O)[C@@H]1CCCC2(C)C |
| InChI | InChI=1S/C27H42N4O2/c1-18(12-16-31-17-28-23-22(31)24(32)29-20(3)30(23)7)10-14-26(6)19(2)11-15-27(33)21(26)9-8-13-25(27,4)5/h12,17,19,21,33H,8-11,13-16H2,1-7H3/t19-,21-,26+,27+/m1/s1 |
| InChIKey | OXCDHWORFBVURJ-QOMJKCBLSA-N |
| XLogP | 5.16 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|