C18H30O2 — CID 10880439
(3'R,4'S,4'aR,8'S,8'aS)-4'-ethenyl-3',4',8',8'a-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4a,5,7,8-hexahydro-1H-naphthalene] (PubChem CID 10880439) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (3'R,4'S,4'aR,8'S,8'aS)-4'-ethenyl-3',4',8',8'a-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4a,5,7,8-hexahydro-1H-naphthalene].
| Compound Name | (3'R,4'S,4'aR,8'S,8'aS)-4'-ethenyl-3',4',8',8'a-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4a,5,7,8-hexahydro-1H-naphthalene] |
|---|---|
| PubChem CID | 10880439 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (3'R,4'S,4'aR,8'S,8'aS)-4'-ethenyl-3',4',8',8'a-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4a,5,7,8-hexahydro-1H-naphthalene] |
| SMILES | C=C[C@@]1(C)[C@H](C)CC[C@@]2(C)[C@@H](C)CC3(C[C@@H]12)OCCO3 |
| InChI | InChI=1S/C18H30O2/c1-6-16(4)13(2)7-8-17(5)14(3)11-18(12-15(16)17)19-9-10-20-18/h6,13-15H,1,7-12H2,2-5H3/t13-,14+,15+,16+,17+/m1/s1 |
| InChIKey | VLAXVGHUTXDUFM-XAJHFOFHSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|