C33H42O10 — CID 162871631
[(1S,2R,3aR,4S,5Z,7S,11S,12E,13aS)-3a,4,11-triacetyloxy-7-hydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,7,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate (PubChem CID 162871631) has the molecular formula C33H42O10 and a molecular weight of 598.69 g/mol. Its IUPAC name is [(1S,2R,3aR,4S,5Z,7S,11S,12E,13aS)-3a,4,11-triacetyloxy-7-hydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,7,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate.
| Compound Name | [(1S,2R,3aR,4S,5Z,7S,11S,12E,13aS)-3a,4,11-triacetyloxy-7-hydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,7,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate |
|---|---|
| PubChem CID | 162871631 |
| Molecular Formula | C33H42O10 |
| Molecular Weight | 598.69 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | [(1S,2R,3aR,4S,5Z,7S,11S,12E,13aS)-3a,4,11-triacetyloxy-7-hydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,7,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate |
| SMILES | CC(=O)O[C@H]1CC(=O)C(C)(C)[C@@H](O)/C=C(/C)[C@H](OC(C)=O)[C@@]2(OC(C)=O)C[C@@H](C)[C@H](OC(=O)c3ccccc3)[C@@H]2/C=C/1C |
| InChI | InChI=1S/C33H42O10/c1-18-14-25-29(42-31(39)24-12-10-9-11-13-24)20(3)17-33(25,43-23(6)36)30(41-22(5)35)19(2)15-27(37)32(7,8)28(38)16-26(18)40-21(4)34/h9-15,20,25-27,29-30,37H,16-17H2,1-8H3/b18-14+,19-15-/t20-,25+,26+,27+,29+,30+,33-/m1/s1 |
| InChIKey | RWZRNGOVGSXIQY-QYWPRYCRSA-N |
| XLogP | 4.29 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.69 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|