C29H38O7 — CID 163074603
[(1S,2R,3aR,4R,5R,11R,13aS)-3a-acetyloxy-4,11-dihydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate (PubChem CID 163074603) has the molecular formula C29H38O7 and a molecular weight of 498.62 g/mol. Its IUPAC name is [(1S,2R,3aR,4R,5R,11R,13aS)-3a-acetyloxy-4,11-dihydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate.
| Compound Name | [(1S,2R,3aR,4R,5R,11R,13aS)-3a-acetyloxy-4,11-dihydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate |
|---|---|
| PubChem CID | 163074603 |
| Molecular Formula | C29H38O7 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [(1S,2R,3aR,4R,5R,11R,13aS)-3a-acetyloxy-4,11-dihydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] benzoate |
| SMILES | CC(=O)O[C@]12C[C@@H](C)[C@H](OC(=O)c3ccccc3)[C@@H]1C=C(C)[C@H](O)CC(=O)C(C)(C)C=C[C@@H](C)[C@H]2O |
| InChI | InChI=1S/C29H38O7/c1-17-12-13-28(5,6)24(32)15-23(31)18(2)14-22-25(35-27(34)21-10-8-7-9-11-21)19(3)16-29(22,26(17)33)36-20(4)30/h7-14,17,19,22-23,25-26,31,33H,15-16H2,1-6H3/t17-,19-,22+,23-,25+,26-,29-/m1/s1 |
| InChIKey | YJUWVRZMROPFRS-CHAOZBEUSA-N |
| XLogP | 4.03 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|