C26H38O6 — CID 162874780
16-(4-methoxy-2-methyl-4-oxobut-2-enoyl)oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid (PubChem CID 162874780) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is 16-(4-methoxy-2-methyl-4-oxobut-2-enoyl)oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid.
| Compound Name | 16-(4-methoxy-2-methyl-4-oxobut-2-enoyl)oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid |
|---|---|
| PubChem CID | 162874780 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 16-(4-methoxy-2-methyl-4-oxobut-2-enoyl)oxy-2,6,10,14-tetramethylhexadeca-2,6,10,14-tetraenoic acid |
| SMILES | COC(=O)C=C(C)C(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C(=O)O |
| InChI | InChI=1S/C26H38O6/c1-19(10-7-11-20(2)14-9-15-22(4)25(28)29)12-8-13-21(3)16-17-32-26(30)23(5)18-24(27)31-6/h11-12,15-16,18H,7-10,13-14,17H2,1-6H3,(H,28,29) |
| InChIKey | RSIAIWLXCCYWMC-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|