C21H18O15S — CID 162875113
6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxy-4,5-dihydroxy-3-sulfooxyoxane-2-carboxylic acid (PubChem CID 162875113) has the molecular formula C21H18O15S and a molecular weight of 542.43 g/mol. Its IUPAC name is 6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxy-4,5-dihydroxy-3-sulfooxyoxane-2-carboxylic acid.
| Compound Name | 6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxy-4,5-dihydroxy-3-sulfooxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 162875113 |
| Molecular Formula | C21H18O15S |
| Molecular Weight | 542.43 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | 6-[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxochromen-7-yl]oxy-4,5-dihydroxy-3-sulfooxyoxane-2-carboxylic acid |
| SMILES | O=C(O)C1OC(Oc2cc(O)c3c(=O)cc(-c4ccc(O)c(O)c4)oc3c2)C(O)C(O)C1OS(=O)(=O)O |
| InChI | InChI=1S/C21H18O15S/c22-9-2-1-7(3-10(9)23)13-6-12(25)15-11(24)4-8(5-14(15)34-13)33-21-17(27)16(26)18(36-37(30,31)32)19(35-21)20(28)29/h1-6,16-19,21-24,26-27H,(H,28,29)(H,30,31,32) |
| InChIKey | CWLCPGTVYYKODH-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 250.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.43 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|