C31H26O13 — CID 58652855
3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-4,5-dihydroxy-6-[5-hydroxy-2-(4-methylphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid (PubChem CID 58652855) has the molecular formula C31H26O13 and a molecular weight of 606.54 g/mol. Its IUPAC name is 3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-4,5-dihydroxy-6-[5-hydroxy-2-(4-methylphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid.
| Compound Name | 3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-4,5-dihydroxy-6-[5-hydroxy-2-(4-methylphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 58652855 |
| Molecular Formula | C31H26O13 |
| Molecular Weight | 606.54 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | 3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-4,5-dihydroxy-6-[5-hydroxy-2-(4-methylphenyl)-4-oxochromen-7-yl]oxyoxane-2-carboxylic acid |
| SMILES | Cc1ccc(-c2cc(=O)c3c(O)cc(OC4OC(C(=O)O)C(OC(=O)/C=C/c5ccc(O)c(O)c5)C(O)C4O)cc3o2)cc1 |
| InChI | InChI=1S/C31H26O13/c1-14-2-6-16(7-3-14)22-13-21(35)25-20(34)11-17(12-23(25)42-22)41-31-27(38)26(37)28(29(44-31)30(39)40)43-24(36)9-5-15-4-8-18(32)19(33)10-15/h2-13,26-29,31-34,37-38H,1H3,(H,39,40)/b9-5+ |
| InChIKey | TYYRIOLKRSCDPC-WEVVVXLNSA-N |
| XLogP | 2.42 |
| TPSA | 213.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|