C16H24O3 — CID 162875194
(6Z,9S,10E,12Z)-9-hydroxyhexadeca-6,10,12,15-tetraenoic acid (PubChem CID 162875194) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is (6Z,9S,10E,12Z)-9-hydroxyhexadeca-6,10,12,15-tetraenoic acid.
| Compound Name | (6Z,9S,10E,12Z)-9-hydroxyhexadeca-6,10,12,15-tetraenoic acid |
|---|---|
| PubChem CID | 162875194 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (6Z,9S,10E,12Z)-9-hydroxyhexadeca-6,10,12,15-tetraenoic acid |
| SMILES | C=CC/C=C\C=C\[C@@H](O)C/C=C\CCCCC(=O)O |
| InChI | InChI=1S/C16H24O3/c1-2-3-4-6-9-12-15(17)13-10-7-5-8-11-14-16(18)19/h2,4,6-7,9-10,12,15,17H,1,3,5,8,11,13-14H2,(H,18,19)/b6-4-,10-7-,12-9+/t15-/m1/s1 |
| InChIKey | NFDPIAFIGHELOJ-FJQSMFNXSA-N |
| XLogP | 3.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|