C25H46N2O7 — CID 162876267
2-[[4-carboxy-2-[(3-hydroxy-11-methyltridecanoyl)amino]butanoyl]amino]-4-methylpentanoic acid (PubChem CID 162876267) has the molecular formula C25H46N2O7 and a molecular weight of 486.65 g/mol. Its IUPAC name is 2-[[4-carboxy-2-[(3-hydroxy-11-methyltridecanoyl)amino]butanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[4-carboxy-2-[(3-hydroxy-11-methyltridecanoyl)amino]butanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 162876267 |
| Molecular Formula | C25H46N2O7 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | 2-[[4-carboxy-2-[(3-hydroxy-11-methyltridecanoyl)amino]butanoyl]amino]-4-methylpentanoic acid |
| SMILES | CCC(C)CCCCCCCC(O)CC(=O)NC(CCC(=O)O)C(=O)NC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C25H46N2O7/c1-5-18(4)11-9-7-6-8-10-12-19(28)16-22(29)26-20(13-14-23(30)31)24(32)27-21(25(33)34)15-17(2)3/h17-21,28H,5-16H2,1-4H3,(H,26,29)(H,27,32)(H,30,31)(H,33,34) |
| InChIKey | BMMGKKOOKSVEEE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 153.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|