C37H66O7 — CID 162877126
(2R)-2-methyl-4-[(2S,10R,11S)-2,10,11-trihydroxy-14-[(2R,5R)-5-[(Z,1S)-1-hydroxytetradec-9-enyl]oxolan-2-yl]tetradecyl]-2H-furan-5-one (PubChem CID 162877126) has the molecular formula C37H66O7 and a molecular weight of 622.93 g/mol. Its IUPAC name is (2R)-2-methyl-4-[(2S,10R,11S)-2,10,11-trihydroxy-14-[(2R,5R)-5-[(Z,1S)-1-hydroxytetradec-9-enyl]oxolan-2-yl]tetradecyl]-2H-furan-5-one.
| Compound Name | (2R)-2-methyl-4-[(2S,10R,11S)-2,10,11-trihydroxy-14-[(2R,5R)-5-[(Z,1S)-1-hydroxytetradec-9-enyl]oxolan-2-yl]tetradecyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 162877126 |
| Molecular Formula | C37H66O7 |
| Molecular Weight | 622.93 g/mol |
| Exact Mass | 622.48 |
| IUPAC Name | (2R)-2-methyl-4-[(2S,10R,11S)-2,10,11-trihydroxy-14-[(2R,5R)-5-[(Z,1S)-1-hydroxytetradec-9-enyl]oxolan-2-yl]tetradecyl]-2H-furan-5-one |
| SMILES | CCCC/C=C\CCCCCCC[C@H](O)[C@H]1CC[C@@H](CCC[C@H](O)[C@H](O)CCCCCCC[C@H](O)CC2=C[C@@H](C)OC2=O)O1 |
| InChI | InChI=1S/C37H66O7/c1-3-4-5-6-7-8-9-10-11-14-18-23-35(41)36-26-25-32(44-36)21-19-24-34(40)33(39)22-17-15-12-13-16-20-31(38)28-30-27-29(2)43-37(30)42/h6-7,27,29,31-36,38-41H,3-5,8-26,28H2,1-2H3/b7-6-/t29-,31+,32-,33-,34+,35+,36-/m1/s1 |
| InChIKey | LENXDXYFHDZCNH-YYZAJLLESA-N |
| XLogP | 7.62 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.93 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|