C26H46O7 — CID 163050748
(2R)-4-[(2S)-2-hydroxy-6-[(2S,5S)-5-[(1S,4S,5S)-1,4,5-trihydroxyundecyl]oxolan-2-yl]hexyl]-2-methyl-2H-furan-5-one (PubChem CID 163050748) has the molecular formula C26H46O7 and a molecular weight of 470.65 g/mol. Its IUPAC name is (2R)-4-[(2S)-2-hydroxy-6-[(2S,5S)-5-[(1S,4S,5S)-1,4,5-trihydroxyundecyl]oxolan-2-yl]hexyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2R)-4-[(2S)-2-hydroxy-6-[(2S,5S)-5-[(1S,4S,5S)-1,4,5-trihydroxyundecyl]oxolan-2-yl]hexyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 163050748 |
| Molecular Formula | C26H46O7 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | (2R)-4-[(2S)-2-hydroxy-6-[(2S,5S)-5-[(1S,4S,5S)-1,4,5-trihydroxyundecyl]oxolan-2-yl]hexyl]-2-methyl-2H-furan-5-one |
| SMILES | CCCCCC[C@H](O)[C@@H](O)CC[C@H](O)[C@@H]1CC[C@H](CCCC[C@H](O)CC2=C[C@@H](C)OC2=O)O1 |
| InChI | InChI=1S/C26H46O7/c1-3-4-5-6-11-22(28)23(29)13-14-24(30)25-15-12-21(33-25)10-8-7-9-20(27)17-19-16-18(2)32-26(19)31/h16,18,20-25,27-30H,3-15,17H2,1-2H3/t18-,20+,21+,22+,23+,24+,25+/m1/s1 |
| InChIKey | CTUPPWQYDNGORK-AIVCMVMSSA-N |
| XLogP | 3.55 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|