C35H62O8 — CID 162894052
(2R)-4-[(2R)-7-[(2S,5S)-5-[(1R,4R)-1,4-dihydroxy-4-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]-2-hydroxyheptyl]-2-methyl-2H-furan-5-one (PubChem CID 162894052) has the molecular formula C35H62O8 and a molecular weight of 610.87 g/mol. Its IUPAC name is (2R)-4-[(2R)-7-[(2S,5S)-5-[(1R,4R)-1,4-dihydroxy-4-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]-2-hydroxyheptyl]-2-methyl-2H-furan-5-one.
| Compound Name | (2R)-4-[(2R)-7-[(2S,5S)-5-[(1R,4R)-1,4-dihydroxy-4-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]-2-hydroxyheptyl]-2-methyl-2H-furan-5-one |
|---|---|
| PubChem CID | 162894052 |
| Molecular Formula | C35H62O8 |
| Molecular Weight | 610.87 g/mol |
| Exact Mass | 610.44 |
| IUPAC Name | (2R)-4-[(2R)-7-[(2S,5S)-5-[(1R,4R)-1,4-dihydroxy-4-[(2S,5R)-5-[(1R)-1-hydroxyundecyl]oxolan-2-yl]butyl]oxolan-2-yl]-2-hydroxyheptyl]-2-methyl-2H-furan-5-one |
| SMILES | CCCCCCCCCC[C@@H](O)[C@H]1CC[C@@H]([C@H](O)CC[C@@H](O)[C@@H]2CC[C@H](CCCCC[C@@H](O)CC3=C[C@@H](C)OC3=O)O2)O1 |
| InChI | InChI=1S/C35H62O8/c1-3-4-5-6-7-8-9-13-16-29(37)33-21-22-34(43-33)31(39)19-18-30(38)32-20-17-28(42-32)15-12-10-11-14-27(36)24-26-23-25(2)41-35(26)40/h23,25,27-34,36-39H,3-22,24H2,1-2H3/t25-,27-,28+,29-,30-,31-,32+,33-,34+/m1/s1 |
| InChIKey | FTBUPRVFMAYNFL-LZXCIICTSA-N |
| XLogP | 6.05 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.87 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|