C18H30O3 — CID 162878950
(9R)-9-hydroxyoctadeca-6,10,12-trienoic acid (PubChem CID 162878950) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is (9R)-9-hydroxyoctadeca-6,10,12-trienoic acid.
| Compound Name | (9R)-9-hydroxyoctadeca-6,10,12-trienoic acid |
|---|---|
| PubChem CID | 162878950 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | (9R)-9-hydroxyoctadeca-6,10,12-trienoic acid |
| SMILES | CCCCCC=CC=C[C@H](O)CC=CCCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h6,8-9,11-12,14,17,19H,2-5,7,10,13,15-16H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | JIYAONITMKZUHD-KRWDZBQOSA-N |
| XLogP | 4.63 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|