C18H28O10 — CID 162880206
methyl (1R,2R,3aS,7R,7aS)-2-hydroxy-1-methyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxy-2,3,3a,6,7,7a-hexahydro-1H-indene-4-carboxylate (PubChem CID 162880206) has the molecular formula C18H28O10 and a molecular weight of 404.41 g/mol. Its IUPAC name is methyl (1R,2R,3aS,7R,7aS)-2-hydroxy-1-methyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxy-2,3,3a,6,7,7a-hexahydro-1H-indene-4-carboxylate.
| Compound Name | methyl (1R,2R,3aS,7R,7aS)-2-hydroxy-1-methyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxy-2,3,3a,6,7,7a-hexahydro-1H-indene-4-carboxylate |
|---|---|
| PubChem CID | 162880206 |
| Molecular Formula | C18H28O10 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | methyl (1R,2R,3aS,7R,7aS)-2-hydroxy-1-methyl-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]peroxy-2,3,3a,6,7,7a-hexahydro-1H-indene-4-carboxylate |
| SMILES | COC(=O)C1=CC[C@@H](OO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]2[C@@H](C)[C@H](O)C[C@H]12 |
| InChI | InChI=1S/C18H28O10/c1-7-10(20)5-9-8(17(24)25-2)3-4-11(13(7)9)27-28-18-16(23)15(22)14(21)12(6-19)26-18/h3,7,9-16,18-23H,4-6H2,1-2H3/t7-,9+,10+,11+,12+,13+,14+,15-,16+,18-/m0/s1 |
| InChIKey | WWANWAJXDXUPRU-FMYLLROCSA-N |
| XLogP | -1.76 |
| TPSA | 155.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|