C22H36O4 — CID 162882279
(3R)-5-[(1R,2S,5R,8aS)-5-(acetyloxymethyl)-1,2,5-trimethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpentanoic acid (PubChem CID 162882279) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is (3R)-5-[(1R,2S,5R,8aS)-5-(acetyloxymethyl)-1,2,5-trimethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpentanoic acid.
| Compound Name | (3R)-5-[(1R,2S,5R,8aS)-5-(acetyloxymethyl)-1,2,5-trimethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 162882279 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | (3R)-5-[(1R,2S,5R,8aS)-5-(acetyloxymethyl)-1,2,5-trimethyl-2,3,6,7,8,8a-hexahydronaphthalen-1-yl]-3-methylpentanoic acid |
| SMILES | CC(=O)OC[C@]1(C)CCC[C@@H]2C1=CC[C@H](C)[C@@]2(C)CC[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C22H36O4/c1-15(13-20(24)25)10-12-22(5)16(2)8-9-18-19(22)7-6-11-21(18,4)14-26-17(3)23/h9,15-16,19H,6-8,10-14H2,1-5H3,(H,24,25)/t15-,16+,19-,21+,22-/m1/s1 |
| InChIKey | AQFJNPAKSUOMPS-ZBWGPZDVSA-N |
| XLogP | 5.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|