C13H24 — CID 162882634
trans-(1S,2S)-1,2-diethyl-4-propan-2-ylidenecyclohexane (PubChem CID 162882634) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is trans-(1S,2S)-1,2-diethyl-4-propan-2-ylidenecyclohexane.
| Compound Name | trans-(1S,2S)-1,2-diethyl-4-propan-2-ylidenecyclohexane |
|---|---|
| PubChem CID | 162882634 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | trans-(1S,2S)-1,2-diethyl-4-propan-2-ylidenecyclohexane |
| SMILES | CC[C@H]1CCC(=C(C)C)C[C@@H]1CC |
| InChI | InChI=1S/C13H24/c1-5-11-7-8-13(10(3)4)9-12(11)6-2/h11-12H,5-9H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | ZJRUGJMFHHMEOY-RYUDHWBXSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|