C32H52O4 — CID 162883206
[6-(3,15-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enyl] acetate (PubChem CID 162883206) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is [6-(3,15-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enyl] acetate.
| Compound Name | [6-(3,15-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enyl] acetate |
|---|---|
| PubChem CID | 162883206 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | [6-(3,15-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enyl] acetate |
| SMILES | CC(=O)OCC(C)=CCCC(C)C1CC(O)C2(C)C1=CCC1C3(C)CCC(O)C(C)(C)C3CCC12C |
| InChI | InChI=1S/C32H52O4/c1-20(19-36-22(3)33)10-9-11-21(2)23-18-28(35)32(8)24(23)12-13-26-30(6)16-15-27(34)29(4,5)25(30)14-17-31(26,32)7/h10,12,21,23,25-28,34-35H,9,11,13-19H2,1-8H3 |
| InChIKey | RCFMRNLDKBIWNV-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|