C32H50O4 — CID 6479439
(E,6R)-6-[(3S,5R,8S,9S,10R,14R,17R)-3-acetyloxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid (PubChem CID 6479439) has the molecular formula C32H50O4 and a molecular weight of 498.75 g/mol. Its IUPAC name is (E,6R)-6-[(3S,5R,8S,9S,10R,14R,17R)-3-acetyloxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid.
| Compound Name | (E,6R)-6-[(3S,5R,8S,9S,10R,14R,17R)-3-acetyloxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 6479439 |
| Molecular Formula | C32H50O4 |
| Molecular Weight | 498.75 g/mol |
| Exact Mass | 498.37 |
| IUPAC Name | (E,6R)-6-[(3S,5R,8S,9S,10R,14R,17R)-3-acetyloxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)[C@@H](CC[C@@]3(C)[C@H]2CC=C2[C@@H]([C@H](C)CC/C=C(\C)C(=O)O)CC[C@@]23C)C1(C)C |
| InChI | InChI=1S/C32H50O4/c1-20(10-9-11-21(2)28(34)35)23-14-18-31(7)24(23)12-13-26-30(6)17-16-27(36-22(3)33)29(4,5)25(30)15-19-32(26,31)8/h11-12,20,23,25-27H,9-10,13-19H2,1-8H3,(H,34,35)/b21-11+/t20-,23-,25+,26+,27+,30+,31+,32+/m1/s1 |
| InChIKey | YZQCQHGVDKAQIE-FXCZGFCUSA-N |
| XLogP | 7.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.75 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|