C32H48O4 — CID 102332090
(E,6R)-6-[(3R,5R,9R,10R,13S,14R,17R)-3-acetyloxy-4,4,10,14-tetramethyl-12-methylidene-2,3,5,6,9,11,13,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid (PubChem CID 102332090) has the molecular formula C32H48O4 and a molecular weight of 496.73 g/mol. Its IUPAC name is (E,6R)-6-[(3R,5R,9R,10R,13S,14R,17R)-3-acetyloxy-4,4,10,14-tetramethyl-12-methylidene-2,3,5,6,9,11,13,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid.
| Compound Name | (E,6R)-6-[(3R,5R,9R,10R,13S,14R,17R)-3-acetyloxy-4,4,10,14-tetramethyl-12-methylidene-2,3,5,6,9,11,13,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 102332090 |
| Molecular Formula | C32H48O4 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | (E,6R)-6-[(3R,5R,9R,10R,13S,14R,17R)-3-acetyloxy-4,4,10,14-tetramethyl-12-methylidene-2,3,5,6,9,11,13,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |
| SMILES | C=C1C[C@H]2C(=CC[C@H]3C(C)(C)[C@H](OC(C)=O)CC[C@]23C)[C@]2(C)CC[C@H]([C@H](C)CC/C=C(\C)C(=O)O)[C@@H]12 |
| InChI | InChI=1S/C32H48O4/c1-19(10-9-11-20(2)29(34)35)23-14-16-32(8)24-12-13-26-30(5,6)27(36-22(4)33)15-17-31(26,7)25(24)18-21(3)28(23)32/h11-12,19,23,25-28H,3,9-10,13-18H2,1-2,4-8H3,(H,34,35)/b20-11+/t19-,23-,25+,26+,27-,28-,31-,32+/m1/s1 |
| InChIKey | BBMSARKIPIKXRC-NGWIQAJASA-N |
| XLogP | 7.75 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|