C32H48O6 — CID 122210681
(Z,6R)-6-[(1S,5R,7R,10S,11S,13S)-7-acetyloxy-13-hydroxy-1,6,6,10-tetramethyl-14-methylidene-18-oxatetracyclo[11.4.1.02,11.05,10]octadec-2-en-15-yl]-2-methylhept-2-enoic acid (PubChem CID 122210681) has the molecular formula C32H48O6 and a molecular weight of 528.73 g/mol. Its IUPAC name is (Z,6R)-6-[(1S,5R,7R,10S,11S,13S)-7-acetyloxy-13-hydroxy-1,6,6,10-tetramethyl-14-methylidene-18-oxatetracyclo[11.4.1.02,11.05,10]octadec-2-en-15-yl]-2-methylhept-2-enoic acid.
| Compound Name | (Z,6R)-6-[(1S,5R,7R,10S,11S,13S)-7-acetyloxy-13-hydroxy-1,6,6,10-tetramethyl-14-methylidene-18-oxatetracyclo[11.4.1.02,11.05,10]octadec-2-en-15-yl]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 122210681 |
| Molecular Formula | C32H48O6 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | (Z,6R)-6-[(1S,5R,7R,10S,11S,13S)-7-acetyloxy-13-hydroxy-1,6,6,10-tetramethyl-14-methylidene-18-oxatetracyclo[11.4.1.02,11.05,10]octadec-2-en-15-yl]-2-methylhept-2-enoic acid |
| SMILES | C=C1C([C@H](C)CC/C=C(/C)C(=O)O)CC[C@]2(C)O[C@@]1(O)C[C@@H]1C2=CC[C@H]2C(C)(C)[C@H](OC(C)=O)CC[C@]12C |
| InChI | InChI=1S/C32H48O6/c1-19(10-9-11-20(2)28(34)35)23-14-17-31(8)24-12-13-26-29(5,6)27(37-22(4)33)15-16-30(26,7)25(24)18-32(36,38-31)21(23)3/h11-12,19,23,25-27,36H,3,9-10,13-18H2,1-2,4-8H3,(H,34,35)/b20-11-/t19-,23?,25-,26+,27-,30-,31+,32+/m1/s1 |
| InChIKey | BTAHIRHFQVBZOY-VJMBYTCXSA-N |
| XLogP | 6.59 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|