C32H48O6 — CID 162900996
6-(2-acetyloxy-12-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid (PubChem CID 162900996) has the molecular formula C32H48O6 and a molecular weight of 528.73 g/mol. Its IUPAC name is 6-(2-acetyloxy-12-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid.
| Compound Name | 6-(2-acetyloxy-12-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 162900996 |
| Molecular Formula | C32H48O6 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | 6-(2-acetyloxy-12-hydroxy-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid |
| SMILES | CC(=O)OC1CC2(C)C3CC(O)C4(C)C(C(C)CCC=C(C)C(=O)O)CCC4(C)C3=CCC2C(C)(C)C1=O |
| InChI | InChI=1S/C32H48O6/c1-18(10-9-11-19(2)28(36)37)21-14-15-31(7)22-12-13-25-29(4,5)27(35)24(38-20(3)33)17-30(25,6)23(22)16-26(34)32(21,31)8/h11-12,18,21,23-26,34H,9-10,13-17H2,1-8H3,(H,36,37) |
| InChIKey | NXOXVQGYYIITJE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|