C30H46O5 — CID 146682687
(3S,4R,8R,9R,10S,13R,14S,17R)-17-[(E)-6-carboxyhept-5-en-2-yl]-3-hydroxy-4,9,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4-carboxylic acid (PubChem CID 146682687) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is (3S,4R,8R,9R,10S,13R,14S,17R)-17-[(E)-6-carboxyhept-5-en-2-yl]-3-hydroxy-4,9,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4-carboxylic acid.
| Compound Name | (3S,4R,8R,9R,10S,13R,14S,17R)-17-[(E)-6-carboxyhept-5-en-2-yl]-3-hydroxy-4,9,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4-carboxylic acid |
|---|---|
| PubChem CID | 146682687 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | (3S,4R,8R,9R,10S,13R,14S,17R)-17-[(E)-6-carboxyhept-5-en-2-yl]-3-hydroxy-4,9,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-4-carboxylic acid |
| SMILES | C/C(=C\CCC(C)[C@H]1CC[C@@]2(C)[C@@H]3CC=C4[C@@H](CC[C@H](O)[C@]4(C)C(=O)O)[C@]3(C)CC[C@]12C)C(=O)O |
| InChI | InChI=1S/C30H46O5/c1-18(8-7-9-19(2)25(32)33)20-14-15-29(5)23-12-10-22-21(27(23,3)16-17-28(20,29)4)11-13-24(31)30(22,6)26(34)35/h9-10,18,20-21,23-24,31H,7-8,11-17H2,1-6H3,(H,32,33)(H,34,35)/b19-9+/t18?,20-,21-,23-,24+,27+,28-,29+,30-/m1/s1 |
| InChIKey | HRYAAXQQFUABSY-NWKDZZQZSA-N |
| XLogP | 6.46 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|