C30H48O4 — CID 5320995
(E)-6-[(4S,8R,9R,13R,17R)-3-hydroxy-4-(hydroxymethyl)-4,9,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid (PubChem CID 5320995) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is (E)-6-[(4S,8R,9R,13R,17R)-3-hydroxy-4-(hydroxymethyl)-4,9,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid.
| Compound Name | (E)-6-[(4S,8R,9R,13R,17R)-3-hydroxy-4-(hydroxymethyl)-4,9,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 5320995 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | (E)-6-[(4S,8R,9R,13R,17R)-3-hydroxy-4-(hydroxymethyl)-4,9,13,14-tetramethyl-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |
| SMILES | C/C(=C\CCC(C)[C@H]1CCC2(C)[C@@H]3CC=C4C(CCC(O)[C@]4(C)CO)[C@]3(C)CC[C@]12C)C(=O)O |
| InChI | InChI=1S/C30H48O4/c1-19(8-7-9-20(2)26(33)34)21-14-15-30(6)24-12-10-23-22(11-13-25(32)28(23,4)18-31)27(24,3)16-17-29(21,30)5/h9-10,19,21-22,24-25,31-32H,7-8,11-18H2,1-6H3,(H,33,34)/b20-9+/t19?,21-,22?,24-,25?,27+,28-,29-,30?/m1/s1 |
| InChIKey | OHHLXXAZACOCTQ-ANOGYFOWSA-N |
| XLogP | 6.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|