C32H50O5 — CID 162816152
6-(3-acetyloxy-7-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid (PubChem CID 162816152) has the molecular formula C32H50O5 and a molecular weight of 514.75 g/mol. Its IUPAC name is 6-(3-acetyloxy-7-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid.
| Compound Name | 6-(3-acetyloxy-7-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 162816152 |
| Molecular Formula | C32H50O5 |
| Molecular Weight | 514.75 g/mol |
| Exact Mass | 514.37 |
| IUPAC Name | 6-(3-acetyloxy-7-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-2-methylhept-2-enoic acid |
| SMILES | CC(=O)OC1CCC2(C)C3=C(C(O)CC2C1(C)C)C1(C)CCC(C(C)CCC=C(C)C(=O)O)C1(C)CC3 |
| InChI | InChI=1S/C32H50O5/c1-19(10-9-11-20(2)28(35)36)22-12-17-32(8)27-23(13-16-31(22,32)7)30(6)15-14-26(37-21(3)33)29(4,5)25(30)18-24(27)34/h11,19,22,24-26,34H,9-10,12-18H2,1-8H3,(H,35,36) |
| InChIKey | BYWFQQNFDABJID-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.75 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|