C30H48O4 — CID 125416593
(E,6S)-6-[(1R,3S,5R,8S,9S,10S,14S,17S)-1,3-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid (PubChem CID 125416593) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is (E,6S)-6-[(1R,3S,5R,8S,9S,10S,14S,17S)-1,3-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid.
| Compound Name | (E,6S)-6-[(1R,3S,5R,8S,9S,10S,14S,17S)-1,3-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 125416593 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | (E,6S)-6-[(1R,3S,5R,8S,9S,10S,14S,17S)-1,3-dihydroxy-4,4,8,10,14-pentamethyl-2,3,5,6,7,9,11,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylhept-2-enoic acid |
| SMILES | C/C(=C\CC[C@H](C)[C@@H]1CC[C@]2(C)C1=CC[C@@H]1[C@]3(C)[C@H](O)C[C@H](O)C(C)(C)[C@H]3CC[C@@]12C)C(=O)O |
| InChI | InChI=1S/C30H48O4/c1-18(9-8-10-19(2)26(33)34)20-13-15-28(5)21(20)11-12-23-29(28,6)16-14-22-27(3,4)24(31)17-25(32)30(22,23)7/h10-11,18,20,22-25,31-32H,8-9,12-17H2,1-7H3,(H,33,34)/b19-10+/t18-,20-,22+,23-,24-,25+,28+,29-,30+/m0/s1 |
| InChIKey | YQXLCRFLNIXKQV-QJRFNWPSSA-N |
| XLogP | 6.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|