C30H44O3 — CID 125416455
(E,6S)-2-methyl-6-[(5S,8S,9R,10S,14S,17S)-4,4,8,10,14-pentamethyl-3-oxo-5,6,7,9,11,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid (PubChem CID 125416455) has the molecular formula C30H44O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is (E,6S)-2-methyl-6-[(5S,8S,9R,10S,14S,17S)-4,4,8,10,14-pentamethyl-3-oxo-5,6,7,9,11,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid.
| Compound Name | (E,6S)-2-methyl-6-[(5S,8S,9R,10S,14S,17S)-4,4,8,10,14-pentamethyl-3-oxo-5,6,7,9,11,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 125416455 |
| Molecular Formula | C30H44O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (E,6S)-2-methyl-6-[(5S,8S,9R,10S,14S,17S)-4,4,8,10,14-pentamethyl-3-oxo-5,6,7,9,11,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]hept-2-enoic acid |
| SMILES | C/C(=C\CC[C@H](C)[C@@H]1CC[C@]2(C)C1=CC[C@@H]1[C@]3(C)C=CC(=O)C(C)(C)[C@H]3CC[C@@]12C)C(=O)O |
| InChI | InChI=1S/C30H44O3/c1-19(9-8-10-20(2)26(32)33)21-13-17-29(6)22(21)11-12-24-28(5)16-15-25(31)27(3,4)23(28)14-18-30(24,29)7/h10-11,15-16,19,21,23-24H,8-9,12-14,17-18H2,1-7H3,(H,32,33)/b20-10+/t19-,21-,23+,24+,28+,29+,30-/m0/s1 |
| InChIKey | PIOPKGSSDJNWCL-LPEQDHRZSA-N |
| XLogP | 7.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|