C30H42O3 — CID 85129249
2-methyl-6-(4,4,10,13,14-pentamethyl-3-oxo-7,11,12,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl)hept-2-enoic acid (PubChem CID 85129249) has the molecular formula C30H42O3 and a molecular weight of 450.66 g/mol. Its IUPAC name is 2-methyl-6-(4,4,10,13,14-pentamethyl-3-oxo-7,11,12,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl)hept-2-enoic acid.
| Compound Name | 2-methyl-6-(4,4,10,13,14-pentamethyl-3-oxo-7,11,12,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl)hept-2-enoic acid |
|---|---|
| PubChem CID | 85129249 |
| Molecular Formula | C30H42O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 2-methyl-6-(4,4,10,13,14-pentamethyl-3-oxo-7,11,12,15,16,17-hexahydrocyclopenta[a]phenanthren-17-yl)hept-2-enoic acid |
| SMILES | CC(=CCCC(C)C1CCC2(C)C3=C(CCC12C)C1(C)C=CC(=O)C(C)(C)C1=CC3)C(=O)O |
| InChI | InChI=1S/C30H42O3/c1-19(9-8-10-20(2)26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h10,12,15-16,19,21H,8-9,11,13-14,17-18H2,1-7H3,(H,32,33) |
| InChIKey | ZJBYEJNGZLUWAV-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|