C33H52O5 — CID 162883759
[2-(4-formyl-3-hydroxy-4,10,13,14-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-4-hydroxy-6-methyl-5-methylideneheptan-3-yl] acetate (PubChem CID 162883759) has the molecular formula C33H52O5 and a molecular weight of 528.77 g/mol. Its IUPAC name is [2-(4-formyl-3-hydroxy-4,10,13,14-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-4-hydroxy-6-methyl-5-methylideneheptan-3-yl] acetate.
| Compound Name | [2-(4-formyl-3-hydroxy-4,10,13,14-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-4-hydroxy-6-methyl-5-methylideneheptan-3-yl] acetate |
|---|---|
| PubChem CID | 162883759 |
| Molecular Formula | C33H52O5 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | [2-(4-formyl-3-hydroxy-4,10,13,14-tetramethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl)-4-hydroxy-6-methyl-5-methylideneheptan-3-yl] acetate |
| SMILES | C=C(C(C)C)C(O)C(OC(C)=O)C(C)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(O)C(C)(C=O)C1CC3 |
| InChI | InChI=1S/C33H52O5/c1-19(2)20(3)28(37)29(38-22(5)35)21(4)23-12-16-33(9)25-10-11-26-30(6,24(25)13-17-32(23,33)8)15-14-27(36)31(26,7)18-34/h18-19,21,23,26-29,36-37H,3,10-17H2,1-2,4-9H3 |
| InChIKey | KLEPQNPDFVXMQZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|