C20H28O4S — CID 162883872
[(1R,2R,8aR)-7-(2-hydroxypropan-2-yl)-1,8a-dimethyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl] (Z)-2-methyl-3-methylsulfanylprop-2-enoate (PubChem CID 162883872) has the molecular formula C20H28O4S and a molecular weight of 364.51 g/mol. Its IUPAC name is [(1R,2R,8aR)-7-(2-hydroxypropan-2-yl)-1,8a-dimethyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl] (Z)-2-methyl-3-methylsulfanylprop-2-enoate.
| Compound Name | [(1R,2R,8aR)-7-(2-hydroxypropan-2-yl)-1,8a-dimethyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl] (Z)-2-methyl-3-methylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 162883872 |
| Molecular Formula | C20H28O4S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [(1R,2R,8aR)-7-(2-hydroxypropan-2-yl)-1,8a-dimethyl-6-oxo-1,2,3,4-tetrahydronaphthalen-2-yl] (Z)-2-methyl-3-methylsulfanylprop-2-enoate |
| SMILES | CS/C=C(/C)C(=O)O[C@@H]1CCC2=CC(=O)C(C(C)(C)O)=C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C20H28O4S/c1-12(11-25-6)18(22)24-17-8-7-14-9-16(21)15(19(3,4)23)10-20(14,5)13(17)2/h9-11,13,17,23H,7-8H2,1-6H3/b12-11-/t13-,17+,20+/m0/s1 |
| InChIKey | GDVJBLHFEZZYGQ-NQKZJHDASA-N |
| XLogP | 3.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|