C27H28N2O11 — CID 162885442
1-[[(2R,3S,4R)-5-carboxy-3-ethenyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]methyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 162885442) has the molecular formula C27H28N2O11 and a molecular weight of 556.52 g/mol. Its IUPAC name is 1-[[(2R,3S,4R)-5-carboxy-3-ethenyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]methyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid.
| Compound Name | 1-[[(2R,3S,4R)-5-carboxy-3-ethenyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]methyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid |
|---|---|
| PubChem CID | 162885442 |
| Molecular Formula | C27H28N2O11 |
| Molecular Weight | 556.52 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | 1-[[(2R,3S,4R)-5-carboxy-3-ethenyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,4-dihydro-2H-pyran-4-yl]methyl]-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | C=C[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)OC=C(C(=O)O)[C@@H]1Cc1nc(C(=O)O)cc2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C27H28N2O11/c1-2-11-13(7-17-20-14(8-18(28-17)25(36)37)12-5-3-4-6-16(12)29-20)15(24(34)35)10-38-26(11)40-27-23(33)22(32)21(31)19(9-30)39-27/h2-6,8,10-11,13,19,21-23,26-27,29-33H,1,7,9H2,(H,34,35)(H,36,37)/t11-,13+,19+,21+,22-,23+,26+,27-/m0/s1 |
| InChIKey | NZDJYDLHIUUXMC-XFMDPDKHSA-N |
| XLogP | 0.52 |
| TPSA | 211.89 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.52 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|