C29H48O3 — CID 162885820
3-(5,6-dimethylheptan-2-yl)-8,10a-dihydroxy-3a,5b-dimethyl-9-methylidene-1,2,3,4,5,5a,6,7,8,9a,10,10b-dodecahydrocyclopenta[a]fluorene-10-carbaldehyde (PubChem CID 162885820) has the molecular formula C29H48O3 and a molecular weight of 444.70 g/mol. Its IUPAC name is 3-(5,6-dimethylheptan-2-yl)-8,10a-dihydroxy-3a,5b-dimethyl-9-methylidene-1,2,3,4,5,5a,6,7,8,9a,10,10b-dodecahydrocyclopenta[a]fluorene-10-carbaldehyde.
| Compound Name | 3-(5,6-dimethylheptan-2-yl)-8,10a-dihydroxy-3a,5b-dimethyl-9-methylidene-1,2,3,4,5,5a,6,7,8,9a,10,10b-dodecahydrocyclopenta[a]fluorene-10-carbaldehyde |
|---|---|
| PubChem CID | 162885820 |
| Molecular Formula | C29H48O3 |
| Molecular Weight | 444.70 g/mol |
| Exact Mass | 444.36 |
| IUPAC Name | 3-(5,6-dimethylheptan-2-yl)-8,10a-dihydroxy-3a,5b-dimethyl-9-methylidene-1,2,3,4,5,5a,6,7,8,9a,10,10b-dodecahydrocyclopenta[a]fluorene-10-carbaldehyde |
| SMILES | C=C1C(O)CCC2(C)C1C(C=O)C1(O)C3CCC(C(C)CCC(C)C(C)C)C3(C)CCC21 |
| InChI | InChI=1S/C29H48O3/c1-17(2)18(3)8-9-19(4)21-10-11-24-27(21,6)15-13-25-28(7)14-12-23(31)20(5)26(28)22(16-30)29(24,25)32/h16-19,21-26,31-32H,5,8-15H2,1-4,6-7H3 |
| InChIKey | AYOKVOHXEHGCDW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.70 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|