C20H34O3 — CID 162887027
(1S,2S,4S,6S,9R,10E,12R,15R)-15-(2-hydroxypropan-2-yl)-4,9,12-trimethyl-5-oxatricyclo[10.3.0.04,6]pentadec-10-en-2-ol (PubChem CID 162887027) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is (1S,2S,4S,6S,9R,10E,12R,15R)-15-(2-hydroxypropan-2-yl)-4,9,12-trimethyl-5-oxatricyclo[10.3.0.04,6]pentadec-10-en-2-ol.
| Compound Name | (1S,2S,4S,6S,9R,10E,12R,15R)-15-(2-hydroxypropan-2-yl)-4,9,12-trimethyl-5-oxatricyclo[10.3.0.04,6]pentadec-10-en-2-ol |
|---|---|
| PubChem CID | 162887027 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | (1S,2S,4S,6S,9R,10E,12R,15R)-15-(2-hydroxypropan-2-yl)-4,9,12-trimethyl-5-oxatricyclo[10.3.0.04,6]pentadec-10-en-2-ol |
| SMILES | C[C@H]1/C=C/[C@@]2(C)CC[C@@H](C(C)(C)O)[C@@H]2[C@@H](O)C[C@]2(C)O[C@H]2CC1 |
| InChI | InChI=1S/C20H34O3/c1-13-6-7-16-20(5,23-16)12-15(21)17-14(18(2,3)22)9-11-19(17,4)10-8-13/h8,10,13-17,21-22H,6-7,9,11-12H2,1-5H3/b10-8+/t13-,14-,15+,16+,17-,19+,20+/m1/s1 |
| InChIKey | KQLUJCMCAJKOJE-OZSSLZFGSA-N |
| XLogP | 3.68 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|