C23H30O7 — CID 162887825
2-methoxy-4-[2,3,4-trimethoxy-6-[(2R,3R,4R,5R)-5-methoxy-3,4-dimethyloxolan-2-yl]phenyl]phenol (PubChem CID 162887825) has the molecular formula C23H30O7 and a molecular weight of 418.49 g/mol. Its IUPAC name is 2-methoxy-4-[2,3,4-trimethoxy-6-[(2R,3R,4R,5R)-5-methoxy-3,4-dimethyloxolan-2-yl]phenyl]phenol.
| Compound Name | 2-methoxy-4-[2,3,4-trimethoxy-6-[(2R,3R,4R,5R)-5-methoxy-3,4-dimethyloxolan-2-yl]phenyl]phenol |
|---|---|
| PubChem CID | 162887825 |
| Molecular Formula | C23H30O7 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 2-methoxy-4-[2,3,4-trimethoxy-6-[(2R,3R,4R,5R)-5-methoxy-3,4-dimethyloxolan-2-yl]phenyl]phenol |
| SMILES | COc1cc(-c2c([C@@H]3O[C@@H](OC)[C@H](C)[C@H]3C)cc(OC)c(OC)c2OC)ccc1O |
| InChI | InChI=1S/C23H30O7/c1-12-13(2)23(29-7)30-20(12)15-11-18(26-4)21(27-5)22(28-6)19(15)14-8-9-16(24)17(10-14)25-3/h8-13,20,23-24H,1-7H3/t12-,13-,20-,23-/m1/s1 |
| InChIKey | IHPLSJOJWOIKLE-UGKAEFHHSA-N |
| XLogP | 4.41 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |