C16H22O4 — CID 162888455
[(1R,2R,7R,8aR)-8a-hydroxy-1-methyl-3-oxo-7-prop-1-en-2-yl-1,2,5,6,7,8-hexahydronaphthalen-2-yl] acetate (PubChem CID 162888455) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is [(1R,2R,7R,8aR)-8a-hydroxy-1-methyl-3-oxo-7-prop-1-en-2-yl-1,2,5,6,7,8-hexahydronaphthalen-2-yl] acetate.
| Compound Name | [(1R,2R,7R,8aR)-8a-hydroxy-1-methyl-3-oxo-7-prop-1-en-2-yl-1,2,5,6,7,8-hexahydronaphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 162888455 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [(1R,2R,7R,8aR)-8a-hydroxy-1-methyl-3-oxo-7-prop-1-en-2-yl-1,2,5,6,7,8-hexahydronaphthalen-2-yl] acetate |
| SMILES | C=C(C)[C@@H]1CCC2=CC(=O)[C@H](OC(C)=O)[C@@H](C)[C@]2(O)C1 |
| InChI | InChI=1S/C16H22O4/c1-9(2)12-5-6-13-7-14(18)15(20-11(4)17)10(3)16(13,19)8-12/h7,10,12,15,19H,1,5-6,8H2,2-4H3/t10-,12-,15-,16-/m1/s1 |
| InChIKey | ZVBRUCKYHKZMAX-QTDMDRALSA-N |
| XLogP | 2.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|