C30H46O3 — CID 162889722
4,8,9,14,17,20-hexamethyl-22-oxahexacyclo[18.3.2.01,18.04,17.05,14.08,13]pentacosane-10,23-dione (PubChem CID 162889722) has the molecular formula C30H46O3 and a molecular weight of 454.70 g/mol. Its IUPAC name is 4,8,9,14,17,20-hexamethyl-22-oxahexacyclo[18.3.2.01,18.04,17.05,14.08,13]pentacosane-10,23-dione.
| Compound Name | 4,8,9,14,17,20-hexamethyl-22-oxahexacyclo[18.3.2.01,18.04,17.05,14.08,13]pentacosane-10,23-dione |
|---|---|
| PubChem CID | 162889722 |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.70 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | 4,8,9,14,17,20-hexamethyl-22-oxahexacyclo[18.3.2.01,18.04,17.05,14.08,13]pentacosane-10,23-dione |
| SMILES | CC1C(=O)CCC2C1(C)CCC1C2(C)CCC2(C)C3CC4(C)CCC3(CCC12C)C(=O)OC4 |
| InChI | InChI=1S/C30H46O3/c1-19-20(31)7-8-21-26(19,3)10-9-22-27(21,4)12-13-29(6)23-17-25(2)11-15-30(23,24(32)33-18-25)16-14-28(22,29)5/h19,21-23H,7-18H2,1-6H3 |
| InChIKey | OODUENSZRKQJCD-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.70 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |