C27H41NO7 — CID 162889728
[5-acetyloxy-4-hydroxy-10-methyl-2-oxo-3-(piperidin-1-ylmethyl)-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-6-yl]methyl 2-methylbutanoate (PubChem CID 162889728) has the molecular formula C27H41NO7 and a molecular weight of 491.63 g/mol. Its IUPAC name is [5-acetyloxy-4-hydroxy-10-methyl-2-oxo-3-(piperidin-1-ylmethyl)-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-6-yl]methyl 2-methylbutanoate.
| Compound Name | [5-acetyloxy-4-hydroxy-10-methyl-2-oxo-3-(piperidin-1-ylmethyl)-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-6-yl]methyl 2-methylbutanoate |
|---|---|
| PubChem CID | 162889728 |
| Molecular Formula | C27H41NO7 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.29 |
| IUPAC Name | [5-acetyloxy-4-hydroxy-10-methyl-2-oxo-3-(piperidin-1-ylmethyl)-3a,4,5,8,9,11a-hexahydro-3H-cyclodeca[b]furan-6-yl]methyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCC1=CCCC(C)=CC2OC(=O)C(CN3CCCCC3)C2C(O)C1OC(C)=O |
| InChI | InChI=1S/C27H41NO7/c1-5-18(3)26(31)33-16-20-11-9-10-17(2)14-22-23(24(30)25(20)34-19(4)29)21(27(32)35-22)15-28-12-7-6-8-13-28/h11,14,18,21-25,30H,5-10,12-13,15-16H2,1-4H3 |
| InChIKey | JFBIUVKGFWELMB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|