C22H30O4 — CID 162890487
(2R,8S)-8-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2,6,8-trimethyl-2,3-dihydrochromene-4,7-dione (PubChem CID 162890487) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is (2R,8S)-8-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2,6,8-trimethyl-2,3-dihydrochromene-4,7-dione.
| Compound Name | (2R,8S)-8-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2,6,8-trimethyl-2,3-dihydrochromene-4,7-dione |
|---|---|
| PubChem CID | 162890487 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | (2R,8S)-8-[(2E)-3,7-dimethylocta-2,6-dienyl]-5-hydroxy-2,6,8-trimethyl-2,3-dihydrochromene-4,7-dione |
| SMILES | CC(C)=CCC/C(C)=C/C[C@]1(C)C(=O)C(C)=C(O)C2=C1O[C@H](C)CC2=O |
| InChI | InChI=1S/C22H30O4/c1-13(2)8-7-9-14(3)10-11-22(6)20(25)16(5)19(24)18-17(23)12-15(4)26-21(18)22/h8,10,15,24H,7,9,11-12H2,1-6H3/b14-10+/t15-,22-/m1/s1 |
| InChIKey | OEDQLGJPWHJKOM-BRKLXWMCSA-N |
| XLogP | 5.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|