C15H22O3 — CID 162891002
(6R)-6-[(2S,3R)-3-hydroxy-6-methyl-4-oxohept-5-en-2-yl]-3-methylcyclohex-2-en-1-one (PubChem CID 162891002) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (6R)-6-[(2S,3R)-3-hydroxy-6-methyl-4-oxohept-5-en-2-yl]-3-methylcyclohex-2-en-1-one.
| Compound Name | (6R)-6-[(2S,3R)-3-hydroxy-6-methyl-4-oxohept-5-en-2-yl]-3-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 162891002 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (6R)-6-[(2S,3R)-3-hydroxy-6-methyl-4-oxohept-5-en-2-yl]-3-methylcyclohex-2-en-1-one |
| SMILES | CC(C)=CC(=O)[C@H](O)[C@@H](C)[C@H]1CCC(C)=CC1=O |
| InChI | InChI=1S/C15H22O3/c1-9(2)7-14(17)15(18)11(4)12-6-5-10(3)8-13(12)16/h7-8,11-12,15,18H,5-6H2,1-4H3/t11-,12+,15+/m0/s1 |
| InChIKey | FDHKMSTZGVPARH-YWPYICTPSA-N |
| XLogP | 2.44 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|