C20H30O3 — CID 162891035
(3aS,5E,9S,12aR)-9-hydroperoxy-3a,6-dimethyl-10-methylidene-1-propan-2-ylidene-3,4,7,8,9,11,12,12a-octahydrocyclopenta[11]annulen-2-one (PubChem CID 162891035) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3aS,5E,9S,12aR)-9-hydroperoxy-3a,6-dimethyl-10-methylidene-1-propan-2-ylidene-3,4,7,8,9,11,12,12a-octahydrocyclopenta[11]annulen-2-one.
| Compound Name | (3aS,5E,9S,12aR)-9-hydroperoxy-3a,6-dimethyl-10-methylidene-1-propan-2-ylidene-3,4,7,8,9,11,12,12a-octahydrocyclopenta[11]annulen-2-one |
|---|---|
| PubChem CID | 162891035 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3aS,5E,9S,12aR)-9-hydroperoxy-3a,6-dimethyl-10-methylidene-1-propan-2-ylidene-3,4,7,8,9,11,12,12a-octahydrocyclopenta[11]annulen-2-one |
| SMILES | C=C1CC[C@H]2C(=C(C)C)C(=O)C[C@]2(C)C/C=C(\C)CC[C@@H]1OO |
| InChI | InChI=1S/C20H30O3/c1-13(2)19-16-8-7-15(4)18(23-22)9-6-14(3)10-11-20(16,5)12-17(19)21/h10,16,18,22H,4,6-9,11-12H2,1-3,5H3/b14-10+/t16-,18-,20-/m0/s1 |
| InChIKey | LYFGNPGVAPNYLI-SQKNFRRZSA-N |
| XLogP | 5.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|